C19H25N4O2+ — CID 117072439
N-[(1R,3S)-5-hydroxy-2-adamantyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide (PubChem CID 117072439) has the molecular formula C19H25N4O2+ and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[(1R,3S)-5-hydroxy-2-adamantyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide.
| Compound Name | N-[(1R,3S)-5-hydroxy-2-adamantyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide |
|---|---|
| PubChem CID | 117072439 |
| Molecular Formula | C19H25N4O2+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N-[(1R,3S)-5-hydroxy-2-adamantyl]-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-8-ium-3-carboxamide |
| SMILES | Cc1cc(C)[n+]2[nH]cc(C(=O)NC3[C@@H]4CC5C[C@H]3CC(O)(C5)C4)c2n1 |
| InChI | InChI=1S/C19H24N4O2/c1-10-3-11(2)23-17(21-10)15(9-20-23)18(24)22-16-13-4-12-5-14(16)8-19(25,6-12)7-13/h3,9,12-14,16,25H,4-8H2,1-2H3,(H,22,24)/p+1/t12?,13-,14+,16?,19? |
| InChIKey | XAKHQMQFIBQWBI-MRLIFXTRSA-O |
| XLogP | 1.43 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|