C19H21F6N3O4 — CID 117073227
4-methyl-N-piperidin-3-ylisoquinolin-5-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 117073227) has the molecular formula C19H21F6N3O4 and a molecular weight of 469.38 g/mol. Its IUPAC name is 4-methyl-N-piperidin-3-ylisoquinolin-5-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-methyl-N-piperidin-3-ylisoquinolin-5-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 117073227 |
| Molecular Formula | C19H21F6N3O4 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-methyl-N-piperidin-3-ylisoquinolin-5-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cncc2cccc(NC3CCCNC3)c12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N3.2C2HF3O2/c1-11-8-17-9-12-4-2-6-14(15(11)12)18-13-5-3-7-16-10-13;2*3-2(4,5)1(6)7/h2,4,6,8-9,13,16,18H,3,5,7,10H2,1H3;2*(H,6,7) |
| InChIKey | ZGPQPQXTSFLHDD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |