C26H17F3N2O2 — CID 117073620
9-(4-phenylphenyl)-2,7-phenanthroline;2,2,2-trifluoroacetic acid (PubChem CID 117073620) has the molecular formula C26H17F3N2O2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 9-(4-phenylphenyl)-2,7-phenanthroline;2,2,2-trifluoroacetic acid.
| Compound Name | 9-(4-phenylphenyl)-2,7-phenanthroline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117073620 |
| Molecular Formula | C26H17F3N2O2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 9-(4-phenylphenyl)-2,7-phenanthroline;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(-c2ccc(-c3cnc4ccc5ccncc5c4c3)cc2)cc1 |
| InChI | InChI=1S/C24H16N2.C2HF3O2/c1-2-4-17(5-3-1)18-6-8-19(9-7-18)21-14-22-23-16-25-13-12-20(23)10-11-24(22)26-15-21;3-2(4,5)1(6)7/h1-16H;(H,6,7) |
| InChIKey | QCZNVQDEZVPJPL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|