C33H28Cl3F2N5O3 — CID 11707393
7-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 11707393) has the molecular formula C33H28Cl3F2N5O3 and a molecular weight of 686.97 g/mol. Its IUPAC name is 7-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | 7-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 11707393 |
| Molecular Formula | C33H28Cl3F2N5O3 |
| Molecular Weight | 686.97 g/mol |
| Exact Mass | 685.12 |
| IUPAC Name | 7-[4-[[3-(2-chloro-3,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]phenyl]-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | O=C(C1=C(c2ccc(OCc3nc(-c4c(F)ccc(F)c4Cl)no3)cc2)CC2CNCC1N2)N(Cc1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C33H28Cl3F2N5O3/c34-23-3-1-2-18(30(23)35)15-43(20-6-7-20)33(44)28-22(12-19-13-39-14-26(28)40-19)17-4-8-21(9-5-17)45-16-27-41-32(42-46-27)29-24(37)10-11-25(38)31(29)36/h1-5,8-11,19-20,26,39-40H,6-7,12-16H2 |
| InChIKey | PUFIYEHVOILPPC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.97 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|