C22H16F3N3O3 — CID 117074067
N-[4-(2,7-phenanthrolin-9-yl)phenyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 117074067) has the molecular formula C22H16F3N3O3 and a molecular weight of 427.38 g/mol. Its IUPAC name is N-[4-(2,7-phenanthrolin-9-yl)phenyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-(2,7-phenanthrolin-9-yl)phenyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117074067 |
| Molecular Formula | C22H16F3N3O3 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[4-(2,7-phenanthrolin-9-yl)phenyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)Nc1ccc(-c2cnc3ccc4ccncc4c3c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H15N3O.C2HF3O2/c1-13(24)23-17-5-2-14(3-6-17)16-10-18-19-12-21-9-8-15(19)4-7-20(18)22-11-16;3-2(4,5)1(6)7/h2-12H,1H3,(H,23,24);(H,6,7) |
| InChIKey | UNSLGAUTHKREEX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|