C26H25F6N5O4 — CID 117074668
N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 117074668) has the molecular formula C26H25F6N5O4 and a molecular weight of 585.51 g/mol. Its IUPAC name is N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117074668 |
| Molecular Formula | C26H25F6N5O4 |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | N-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)-4-pyridinyl]amino]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)c1ccccc1Nc1cc(Nc2ccc(N3CCOCC3)cc2)ncc1C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H24F3N5O2.C2HF3O2/c1-28-23(33)18-4-2-3-5-20(18)31-21-14-22(29-15-19(21)24(25,26)27)30-16-6-8-17(9-7-16)32-10-12-34-13-11-32;3-2(4,5)1(6)7/h2-9,14-15H,10-13H2,1H3,(H,28,33)(H2,29,30,31);(H,6,7) |
| InChIKey | SCDXOKMJINOPDF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|