C27H27F6N5O8 — CID 117075690
(3R)-N-[4-(2-aminopyrimidin-4-yl)-2-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 117075690) has the molecular formula C27H27F6N5O8 and a molecular weight of 663.53 g/mol. Its IUPAC name is (3R)-N-[4-(2-aminopyrimidin-4-yl)-2-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R)-N-[4-(2-aminopyrimidin-4-yl)-2-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 117075690 |
| Molecular Formula | C27H27F6N5O8 |
| Molecular Weight | 663.53 g/mol |
| Exact Mass | 663.18 |
| IUPAC Name | (3R)-N-[4-(2-aminopyrimidin-4-yl)-2-[2-(dimethylamino)ethoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCOc1cc(-c2ccnc(N)n2)ccc1NC(=O)[C@H]1COc2ccccc2O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H25N5O4.2C2HF3O2/c1-28(2)11-12-30-20-13-15(16-9-10-25-23(24)27-16)7-8-17(20)26-22(29)21-14-31-18-5-3-4-6-19(18)32-21;2*3-2(4,5)1(6)7/h3-10,13,21H,11-12,14H2,1-2H3,(H,26,29)(H2,24,25,27);2*(H,6,7)/t21-;;/m1../s1 |
| InChIKey | GLSSJFNKVMPCAP-GHVWMZMZSA-N |
| XLogP | 3.71 |
| TPSA | 186.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |