C35H54N2OPtSi2 — CID 11707589
[1,3-Bis(2,6-diisopropyl phenyl)imidazol-2-ylidene][1,3-divinyl-1,1,3,3-tetramethyl disiloxane]platinum(0) (PubChem CID 11707589) has the molecular formula C35H54N2OPtSi2 and a molecular weight of 770.08 g/mol.
| Compound Name | [1,3-Bis(2,6-diisopropyl phenyl)imidazol-2-ylidene][1,3-divinyl-1,1,3,3-tetramethyl disiloxane]platinum(0) |
|---|---|
| PubChem CID | 11707589 |
| Molecular Formula | C35H54N2OPtSi2 |
| Molecular Weight | 770.08 g/mol |
| Exact Mass | 769.34 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)C=C1.[CH2][CH][Si](C)(C)O[Si](C)(C)[CH][CH2].[Pt] |
| InChI | InChI=1S/C27H36N2.C8H18OSi2.Pt/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-7-10(3,4)9-11(5,6)8-2;/h9-16,18-21H,1-8H3;7-8H,1-2H2,3-6H3; |
| InChIKey | WWAXDEMRAUFASV-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.08 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|