C25H24ClN5O — CID 117076290
[3-[5-(2-chloroanilino)indazol-1-yl]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 117076290) has the molecular formula C25H24ClN5O and a molecular weight of 445.95 g/mol. Its IUPAC name is [3-[5-(2-chloroanilino)indazol-1-yl]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-[5-(2-chloroanilino)indazol-1-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 117076290 |
| Molecular Formula | C25H24ClN5O |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [3-[5-(2-chloroanilino)indazol-1-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc(-n3ncc4cc(Nc5ccccc5Cl)ccc43)c2)CC1 |
| InChI | InChI=1S/C25H24ClN5O/c1-29-11-13-30(14-12-29)25(32)18-5-4-6-21(16-18)31-24-10-9-20(15-19(24)17-27-31)28-23-8-3-2-7-22(23)26/h2-10,15-17,28H,11-14H2,1H3 |
| InChIKey | VKBMEFJHNVSTAY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |