C32H37F6N5O8 — CID 117076592
3-N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-N-(2-methylpropyl)-3,4-dihydro-2H-chromene-3,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 117076592) has the molecular formula C32H37F6N5O8 and a molecular weight of 733.66 g/mol. Its IUPAC name is 3-N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-N-(2-methylpropyl)-3,4-dihydro-2H-chromene-3,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-N-(2-methylpropyl)-3,4-dihydro-2H-chromene-3,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 117076592 |
| Molecular Formula | C32H37F6N5O8 |
| Molecular Weight | 733.66 g/mol |
| Exact Mass | 733.25 |
| IUPAC Name | 3-N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-N-(2-methylpropyl)-3,4-dihydro-2H-chromene-3,6-dicarboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)CNC(=O)c1ccc2c(c1)CC(C(=O)Nc1ccc(-c3cn[nH]c3)cc1OCCN(C)C)CO2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H35N5O4.2C2HF3O2/c1-18(2)14-29-27(34)20-6-8-25-21(11-20)12-22(17-37-25)28(35)32-24-7-5-19(23-15-30-31-16-23)13-26(24)36-10-9-33(3)4;2*3-2(4,5)1(6)7/h5-8,11,13,15-16,18,22H,9-10,12,14,17H2,1-4H3,(H,29,34)(H,30,31)(H,32,35);2*(H,6,7) |
| InChIKey | JDPSHIPAAXERKA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 183.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |