C19H16F4N4O3 — CID 117076631
1-benzyl-3-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 117076631) has the molecular formula C19H16F4N4O3 and a molecular weight of 424.35 g/mol. Its IUPAC name is 1-benzyl-3-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-benzyl-3-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117076631 |
| Molecular Formula | C19H16F4N4O3 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-benzyl-3-[2-fluoro-4-(1H-pyrazol-4-yl)phenyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1ccccc1)Nc1ccc(-c2cn[nH]c2)cc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H15FN4O.C2HF3O2/c18-15-8-13(14-10-20-21-11-14)6-7-16(15)22-17(23)19-9-12-4-2-1-3-5-12;3-2(4,5)1(6)7/h1-8,10-11H,9H2,(H,20,21)(H2,19,22,23);(H,6,7) |
| InChIKey | XQCXOTUOLXIIAW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |