C21H22F3N5O3 — CID 117076736
4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 117076736) has the molecular formula C21H22F3N5O3 and a molecular weight of 449.43 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117076736 |
| Molecular Formula | C21H22F3N5O3 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-N-(4-morpholin-4-ylphenyl)pyridin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N5O.C2HF3O2/c1-23-14-16(13-21-23)15-6-7-20-19(12-15)22-17-2-4-18(5-3-17)24-8-10-25-11-9-24;3-2(4,5)1(6)7/h2-7,12-14H,8-11H2,1H3,(H,20,22);(H,6,7) |
| InChIKey | GMAHGTOWJVULHT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|