C25H19F4N7O2S — CID 117078132
N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-4-[3-fluoro-5-(1,3-thiazol-2-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 117078132) has the molecular formula C25H19F4N7O2S and a molecular weight of 557.53 g/mol. Its IUPAC name is N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-4-[3-fluoro-5-(1,3-thiazol-2-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-4-[3-fluoro-5-(1,3-thiazol-2-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117078132 |
| Molecular Formula | C25H19F4N7O2S |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-4-[3-fluoro-5-(1,3-thiazol-2-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(C)n(-c2ccc(Nc3nccc(-c4cc(F)cc(-c5nccs5)c4)n3)cc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H18FN7S.C2HF3O2/c1-14-27-15(2)31(30-14)20-5-3-19(4-6-20)28-23-26-8-7-21(29-23)16-11-17(13-18(24)12-16)22-25-9-10-32-22;3-2(4,5)1(6)7/h3-13H,1-2H3,(H,26,28,29);(H,6,7) |
| InChIKey | KZTJAWWRYTXPAK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |