C19H16N4O2S — CID 117078224
N-benzyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)benzenesulfonamide (PubChem CID 117078224) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-benzyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)benzenesulfonamide.
| Compound Name | N-benzyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 117078224 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-benzyl-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1ccc(-c2ncnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C19H16N4O2S/c24-26(25,23-12-14-4-2-1-3-5-14)16-8-6-15(7-9-16)18-17-10-11-20-19(17)22-13-21-18/h1-11,13,23H,12H2,(H,20,21,22) |
| InChIKey | KBIKVAHJYJUDMV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |