C27H27F5N8O2 — CID 117078249
N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-5-fluoro-4-[3-fluoro-5-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 117078249) has the molecular formula C27H27F5N8O2 and a molecular weight of 590.56 g/mol. Its IUPAC name is N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-5-fluoro-4-[3-fluoro-5-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-5-fluoro-4-[3-fluoro-5-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117078249 |
| Molecular Formula | C27H27F5N8O2 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | N-[4-(3,5-dimethyl-1,2,4-triazol-1-yl)phenyl]-5-fluoro-4-[3-fluoro-5-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(C)n(-c2ccc(Nc3ncc(F)c(-c4cc(F)cc(N5CCN(C)CC5)c4)n3)cc2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26F2N8.C2HF3O2/c1-16-29-17(2)35(32-16)21-6-4-20(5-7-21)30-25-28-15-23(27)24(31-25)18-12-19(26)14-22(13-18)34-10-8-33(3)9-11-34;3-2(4,5)1(6)7/h4-7,12-15H,8-11H2,1-3H3,(H,28,30,31);(H,6,7) |
| InChIKey | MXIGYXPVZUYXKR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |