C21H19F2N7 — CID 117078734
N-[4-(3-tert-butyl-1,2,4-triazol-1-yl)phenyl]-4-(2,6-difluoro-4-pyridinyl)pyrimidin-2-amine (PubChem CID 117078734) has the molecular formula C21H19F2N7 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[4-(3-tert-butyl-1,2,4-triazol-1-yl)phenyl]-4-(2,6-difluoro-4-pyridinyl)pyrimidin-2-amine.
| Compound Name | N-[4-(3-tert-butyl-1,2,4-triazol-1-yl)phenyl]-4-(2,6-difluoro-4-pyridinyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 117078734 |
| Molecular Formula | C21H19F2N7 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[4-(3-tert-butyl-1,2,4-triazol-1-yl)phenyl]-4-(2,6-difluoro-4-pyridinyl)pyrimidin-2-amine |
| SMILES | CC(C)(C)c1ncn(-c2ccc(Nc3nccc(-c4cc(F)nc(F)c4)n3)cc2)n1 |
| InChI | InChI=1S/C21H19F2N7/c1-21(2,3)19-25-12-30(29-19)15-6-4-14(5-7-15)26-20-24-9-8-16(27-20)13-10-17(22)28-18(23)11-13/h4-12H,1-3H3,(H,24,26,27) |
| InChIKey | GULCXHISSSYCSG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|