About 2-oxoacetamide
2-oxoacetamide (PubChem CID 11708045) has the molecular formula C2H3NO2
and a molecular weight of 73.05 g/mol. Its IUPAC name is 2-oxoacetamide.
Molecular Properties
| Compound Name | 2-oxoacetamide |
| PubChem CID | 11708045 |
| Molecular Formula | C2H3NO2 |
| Molecular Weight | 73.05 g/mol |
| Exact Mass | 73.02 |
| IUPAC Name | 2-oxoacetamide |
| SMILES | NC(=O)C=O |
| InChI | InChI=1S/C2H3NO2/c3-2(5)1-4/h1H,(H2,3,5) |
| InChIKey | AMANDCZTVNQSNB-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.05 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoacetamide?
The IUPAC name of 2-oxoacetamide (CID 11708045) is 2-oxoacetamide.
What is the SMILES notation for 2-oxoacetamide?
The canonical SMILES for 2-oxoacetamide is NC(=O)C=O.
What is the InChIKey of 2-oxoacetamide?
The InChIKey is AMANDCZTVNQSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO2/c3-2(5)1-4/h1H,(H2,3,5).
What are the key properties of 2-oxoacetamide?
2-oxoacetamide has a molecular weight of 73.05 g/mol, XLogP of -1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoacetamide is sourced from PubChem (CID 11708045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).