C15H18N6O2S — CID 117080545
N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxamide (PubChem CID 117080545) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117080545 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-2-ylamino)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cnc(Nc2ncccn2)s1 |
| InChI | InChI=1S/C15H18N6O2S/c22-12-4-1-8-21(12)9-3-7-16-13(23)11-10-19-15(24-11)20-14-17-5-2-6-18-14/h2,5-6,10H,1,3-4,7-9H2,(H,16,23)(H,17,18,19,20) |
| InChIKey | CVZAKMWLAFNFJT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|