C21H27N7O4 — CID 117080908
1-[3-[[2-(3,4,5-trimethoxyanilino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 117080908) has the molecular formula C21H27N7O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 1-[3-[[2-(3,4,5-trimethoxyanilino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-(3,4,5-trimethoxyanilino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117080908 |
| Molecular Formula | C21H27N7O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-[3-[[2-(3,4,5-trimethoxyanilino)-7H-purin-6-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | COc1cc(Nc2nc(NCCCN3CCCC3=O)c3[nH]cnc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H27N7O4/c1-30-14-10-13(11-15(31-2)18(14)32-3)25-21-26-19(17-20(27-21)24-12-23-17)22-7-5-9-28-8-4-6-16(28)29/h10-12H,4-9H2,1-3H3,(H3,22,23,24,25,26,27) |
| InChIKey | RYGLKUXHUVIJDS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|