C19H18N8O2 — CID 117081222
6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-pyrazin-2-ylpurine-2,6-diamine (PubChem CID 117081222) has the molecular formula C19H18N8O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-pyrazin-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-pyrazin-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117081222 |
| Molecular Formula | C19H18N8O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-pyrazin-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(Nc3ccc4c(c3)OCO4)nc(Nc3cnccn3)nc21 |
| InChI | InChI=1S/C19H18N8O2/c1-11(2)27-9-22-16-17(23-12-3-4-13-14(7-12)29-10-28-13)25-19(26-18(16)27)24-15-8-20-5-6-21-15/h3-9,11H,10H2,1-2H3,(H2,21,23,24,25,26) |
| InChIKey | MZOPLZHKBXGUOA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |