C24H21N7O2 — CID 117081223
6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-quinolin-6-ylpurine-2,6-diamine (PubChem CID 117081223) has the molecular formula C24H21N7O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-quinolin-6-ylpurine-2,6-diamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-quinolin-6-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117081223 |
| Molecular Formula | C24H21N7O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-yl)-9-propan-2-yl-2-N-quinolin-6-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(Nc3ccc4c(c3)OCO4)nc(Nc3ccc4ncccc4c3)nc21 |
| InChI | InChI=1S/C24H21N7O2/c1-14(2)31-12-26-21-22(27-17-6-8-19-20(11-17)33-13-32-19)29-24(30-23(21)31)28-16-5-7-18-15(10-16)4-3-9-25-18/h3-12,14H,13H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | YKGXLZYVLRGVSR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |