C22H33N7 — CID 117081369
N-[8-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 117081369) has the molecular formula C22H33N7 and a molecular weight of 395.56 g/mol. Its IUPAC name is N-[8-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[8-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 117081369 |
| Molecular Formula | C22H33N7 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N-[8-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNc1ncnc2c1nc(-c1cccc(N)c1)n2C(C)C)C(C)C |
| InChI | InChI=1S/C22H33N7/c1-14(2)28(15(3)4)11-10-24-20-19-22(26-13-25-20)29(16(5)6)21(27-19)17-8-7-9-18(23)12-17/h7-9,12-16H,10-11,23H2,1-6H3,(H,24,25,26) |
| InChIKey | TZTFVBMTPYVRRK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|