C35H35F3N8O3 — CID 117081435
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117081435) has the molecular formula C35H35F3N8O3 and a molecular weight of 672.71 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117081435 |
| Molecular Formula | C35H35F3N8O3 |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(4-morpholin-4-ylphenyl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(Nc4ccc(N5CCOCC5)cc4)nc(N4CCN(Cc5ccc6c(c5)OCO6)CC4)nc32)cc1 |
| InChI | InChI=1S/C35H35F3N8O3/c36-35(37,38)26-4-1-24(2-5-26)21-46-22-39-31-32(40-27-6-8-28(9-7-27)44-15-17-47-18-16-44)41-34(42-33(31)46)45-13-11-43(12-14-45)20-25-3-10-29-30(19-25)49-23-48-29/h1-10,19,22H,11-18,20-21,23H2,(H,40,41,42) |
| InChIKey | XSZHGEZYDNMFBR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|