C12H18O2 — CID 11708216
(3R,3aR,7S,7aR)-3-ethenyl-7-hydroxy-3a-methyl-2,3,5,6,7,7a-hexahydro-1H-inden-4-one (PubChem CID 11708216) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3R,3aR,7S,7aR)-3-ethenyl-7-hydroxy-3a-methyl-2,3,5,6,7,7a-hexahydro-1H-inden-4-one.
| Compound Name | (3R,3aR,7S,7aR)-3-ethenyl-7-hydroxy-3a-methyl-2,3,5,6,7,7a-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 11708216 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3R,3aR,7S,7aR)-3-ethenyl-7-hydroxy-3a-methyl-2,3,5,6,7,7a-hexahydro-1H-inden-4-one |
| SMILES | C=C[C@H]1CC[C@H]2[C@@H](O)CCC(=O)[C@]12C |
| InChI | InChI=1S/C12H18O2/c1-3-8-4-5-9-10(13)6-7-11(14)12(8,9)2/h3,8-10,13H,1,4-7H2,2H3/t8-,9-,10-,12+/m0/s1 |
| InChIKey | VVKCQZNGMWJDBG-QFOLPQNPSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|