C10H17NO3 — CID 11708246
(1R,3R,5R)-1-pyrrol-1-ylhexane-1,3,5-triol (PubChem CID 11708246) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (1R,3R,5R)-1-pyrrol-1-ylhexane-1,3,5-triol.
| Compound Name | (1R,3R,5R)-1-pyrrol-1-ylhexane-1,3,5-triol |
|---|---|
| PubChem CID | 11708246 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (1R,3R,5R)-1-pyrrol-1-ylhexane-1,3,5-triol |
| SMILES | C[C@@H](O)C[C@@H](O)C[C@@H](O)n1cccc1 |
| InChI | InChI=1S/C10H17NO3/c1-8(12)6-9(13)7-10(14)11-4-2-3-5-11/h2-5,8-10,12-14H,6-7H2,1H3/t8-,9-,10-/m1/s1 |
| InChIKey | FOLMXUHJGZBEET-OPRDCNLKSA-N |
| XLogP | 0.50 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |