C22H19N7O — CID 117082496
4-[2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]ethyl]phenol (PubChem CID 117082496) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117082496 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-[2-[[2-(quinolin-6-ylamino)-7H-purin-6-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2nc(Nc3ccc4ncccc4c3)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C22H19N7O/c30-17-6-3-14(4-7-17)9-11-24-20-19-21(26-13-25-19)29-22(28-20)27-16-5-8-18-15(12-16)2-1-10-23-18/h1-8,10,12-13,30H,9,11H2,(H3,24,25,26,27,28,29) |
| InChIKey | HXRKZEHUCYBUTJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |