C22H33N7O2 — CID 117082825
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 117082825) has the molecular formula C22H33N7O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 117082825 |
| Molecular Formula | C22H33N7O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-N,4-N-diethyl-2-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(N(CC)CC)nc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)n1 |
| InChI | InChI=1S/C22H33N7O2/c1-4-9-23-20-24-21(28(5-2)6-3)26-22(25-20)29-12-10-27(11-13-29)15-17-7-8-18-19(14-17)31-16-30-18/h7-8,14H,4-6,9-13,15-16H2,1-3H3,(H,23,24,25,26) |
| InChIKey | YVTTWDWIKALWFX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |