C30H29F3N8O — CID 117083136
N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine (PubChem CID 117083136) has the molecular formula C30H29F3N8O and a molecular weight of 574.61 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine.
| Compound Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 117083136 |
| Molecular Formula | C30H29F3N8O |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-9-[[4-(trifluoromethyl)phenyl]methyl]purin-6-amine |
| SMILES | FC(F)(F)c1ccc(Cn2cnc3c(NCCOc4ccccc4)nc(N4CCN(c5ccccn5)CC4)nc32)cc1 |
| InChI | InChI=1S/C30H29F3N8O/c31-30(32,33)23-11-9-22(10-12-23)20-41-21-36-26-27(35-14-19-42-24-6-2-1-3-7-24)37-29(38-28(26)41)40-17-15-39(16-18-40)25-8-4-5-13-34-25/h1-13,21H,14-20H2,(H,35,37,38) |
| InChIKey | OQQMQEGIKXZLCK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|