C14H17NO — CID 11708326
7,8-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol (PubChem CID 11708326) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 7,8-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol.
| Compound Name | 7,8-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
|---|---|
| PubChem CID | 11708326 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 7,8-dimethyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
| SMILES | Cc1ccc2c3c([nH]c2c1C)CCC(O)C3 |
| InChI | InChI=1S/C14H17NO/c1-8-3-5-11-12-7-10(16)4-6-13(12)15-14(11)9(8)2/h3,5,10,15-16H,4,6-7H2,1-2H3 |
| InChIKey | KUBOYLJSIZGEBA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|