C29H25N7O3 — CID 117083626
2-N-isoquinolin-1-yl-9-phenyl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine (PubChem CID 117083626) has the molecular formula C29H25N7O3 and a molecular weight of 519.57 g/mol. Its IUPAC name is 2-N-isoquinolin-1-yl-9-phenyl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine.
| Compound Name | 2-N-isoquinolin-1-yl-9-phenyl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117083626 |
| Molecular Formula | C29H25N7O3 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-N-isoquinolin-1-yl-9-phenyl-6-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
| SMILES | COc1cc(Nc2nc(Nc3nccc4ccccc34)nc3c2ncn3-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H25N7O3/c1-37-22-15-19(16-23(38-2)25(22)39-3)32-27-24-28(36(17-31-24)20-10-5-4-6-11-20)35-29(34-27)33-26-21-12-8-7-9-18(21)13-14-30-26/h4-17H,1-3H3,(H2,30,32,33,34,35) |
| InChIKey | CFHKLTISMDVCNR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 108.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |