About 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine
6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine (PubChem CID 117084752) has the molecular formula C17H25N9
and a molecular weight of 355.45 g/mol. Its IUPAC name is 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine.
Molecular Properties
| Compound Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine |
| PubChem CID | 117084752 |
| Molecular Formula | C17H25N9 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine |
| SMILES | CC(C)N(CCNc1ncnc2nc(Nc3cnccn3)[nH]c12)C(C)C |
| InChI | InChI=1S/C17H25N9/c1-11(2)26(12(3)4)8-7-20-15-14-16(22-10-21-15)25-17(24-14)23-13-9-18-5-6-19-13/h5-6,9-12H,7-8H2,1-4H3,(H3,19,20,21,22,23,24,25) |
| InChIKey | JLJOPURWXGBZPZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine?
The IUPAC name of 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine (CID 117084752) is 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine.
What is the SMILES notation for 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine?
The canonical SMILES for 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine is CC(C)N(CCNc1ncnc2nc(Nc3cnccn3)[nH]c12)C(C)C.
What is the InChIKey of 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine?
The InChIKey is JLJOPURWXGBZPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N9/c1-11(2)26(12(3)4)8-7-20-15-14-16(22-10-21-15)25-17(24-14)23-13-9-18-5-6-19-13/h5-6,9-12H,7-8H2,1-4H3,(H3,19,20,21,22,23,24,25).
What are the key properties of 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine?
6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine has a molecular weight of 355.45 g/mol, XLogP of 2.42, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-[2-[di(propan-2-yl)amino]ethyl]-8-N-pyrazin-2-yl-7H-purine-6,8-diamine is sourced from PubChem (CID 117084752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).