C16H18N6O — CID 117084853
4-[2-[[6-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]amino]ethyl]phenol (PubChem CID 117084853) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-[2-[[6-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[6-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117084853 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[2-[[6-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]amino]ethyl]phenol |
| SMILES | Cn1nccc1Nc1cc(NCCc2ccc(O)cc2)ncn1 |
| InChI | InChI=1S/C16H18N6O/c1-22-16(7-9-20-22)21-15-10-14(18-11-19-15)17-8-6-12-2-4-13(23)5-3-12/h2-5,7,9-11,23H,6,8H2,1H3,(H2,17,18,19,21) |
| InChIKey | VJSKHEMORGPICV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |