C20H16N6O2 — CID 117084900
6-N-(1,3-benzodioxol-5-yl)-4-N-isoquinolin-1-ylpyrimidine-2,4,6-triamine (PubChem CID 117084900) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-yl)-4-N-isoquinolin-1-ylpyrimidine-2,4,6-triamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-yl)-4-N-isoquinolin-1-ylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 117084900 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-yl)-4-N-isoquinolin-1-ylpyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(Nc2ccc3c(c2)OCO3)cc(Nc2nccc3ccccc23)n1 |
| InChI | InChI=1S/C20H16N6O2/c21-20-25-17(23-13-5-6-15-16(9-13)28-11-27-15)10-18(26-20)24-19-14-4-2-1-3-12(14)7-8-22-19/h1-10H,11H2,(H4,21,22,23,24,25,26) |
| InChIKey | YPLCELNBRALMNB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |