About 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid
2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid (PubChem CID 11708516) has the molecular formula C7H4F3NO3S
and a molecular weight of 239.17 g/mol. Its IUPAC name is 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid |
| PubChem CID | 11708516 |
| Molecular Formula | C7H4F3NO3S |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H4F3NO3S/c8-7(9,10)6(14)11-4-3(5(12)13)1-2-15-4/h1-2H,(H,11,14)(H,12,13) |
| InChIKey | XODRJGQHURCNDJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid?
The IUPAC name of 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid (CID 11708516) is 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid.
What is the SMILES notation for 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid?
The canonical SMILES for 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid is O=C(O)c1ccsc1NC(=O)C(F)(F)F.
What is the InChIKey of 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid?
The InChIKey is XODRJGQHURCNDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3NO3S/c8-7(9,10)6(14)11-4-3(5(12)13)1-2-15-4/h1-2H,(H,11,14)(H,12,13).
What are the key properties of 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid?
2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid has a molecular weight of 239.17 g/mol, XLogP of 1.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylic acid is sourced from PubChem (CID 11708516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).