About 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine
6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine (PubChem CID 117085782) has the molecular formula C26H21N7OS
and a molecular weight of 479.57 g/mol. Its IUPAC name is 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine |
| PubChem CID | 117085782 |
| Molecular Formula | C26H21N7OS |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine |
| SMILES | c1ccc(OCCNc2nc(Nc3ccc4ncccc4c3)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C26H21N7OS/c1-2-6-21(7-3-1)34-13-12-28-24-23-25(33(17-29-23)20-10-14-35-16-20)32-26(31-24)30-19-8-9-22-18(15-19)5-4-11-27-22/h1-11,14-17H,12-13H2,(H2,28,30,31,32) |
| InChIKey | JIFKGSLGPRBZRI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine?
The IUPAC name of 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine (CID 117085782) is 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine.
What is the SMILES notation for 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine?
The canonical SMILES for 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine is c1ccc(OCCNc2nc(Nc3ccc4ncccc4c3)nc3c2ncn3-c2ccsc2)cc1.
What is the InChIKey of 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine?
The InChIKey is JIFKGSLGPRBZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N7OS/c1-2-6-21(7-3-1)34-13-12-28-24-23-25(33(17-29-23)20-10-14-35-16-20)32-26(31-24)30-19-8-9-22-18(15-19)5-4-11-27-22/h1-11,14-17H,12-13H2,(H2,28,30,31,32).
What are the key properties of 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine?
6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine has a molecular weight of 479.57 g/mol, XLogP of 5.66, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(2-phenoxyethyl)-2-N-quinolin-6-yl-9-thiophen-3-ylpurine-2,6-diamine is sourced from PubChem (CID 117085782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).