C24H29F3N6O3 — CID 117086777
2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 117086777) has the molecular formula C24H29F3N6O3 and a molecular weight of 506.53 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117086777 |
| Molecular Formula | C24H29F3N6O3 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 2-N,2-N-diethyl-6-N-[[3-(trifluoromethyl)phenyl]methyl]-4-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCc2cccc(C(F)(F)F)c2)nc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C24H29F3N6O3/c1-6-33(7-2)23-31-21(28-14-15-9-8-10-16(11-15)24(25,26)27)30-22(32-23)29-17-12-18(34-3)20(36-5)19(13-17)35-4/h8-13H,6-7,14H2,1-5H3,(H2,28,29,30,31,32) |
| InChIKey | PNWAJTRTMYZXKY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |