C13H13F3O2 — CID 11708681
5-(4,4,4-trifluorobutoxy)-2,3-dihydroinden-1-one (PubChem CID 11708681) has the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 5-(4,4,4-trifluorobutoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(4,4,4-trifluorobutoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 11708681 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-(4,4,4-trifluorobutoxy)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OCCCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H13F3O2/c14-13(15,16)6-1-7-18-10-3-4-11-9(8-10)2-5-12(11)17/h3-4,8H,1-2,5-7H2 |
| InChIKey | NXDUCJHCTJGKBR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|