C17H28O2 — CID 11708738
(2S)-5-methyl-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]hex-3-yne-2,5-diol (PubChem CID 11708738) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (2S)-5-methyl-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]hex-3-yne-2,5-diol.
| Compound Name | (2S)-5-methyl-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]hex-3-yne-2,5-diol |
|---|---|
| PubChem CID | 11708738 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (2S)-5-methyl-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]hex-3-yne-2,5-diol |
| SMILES | CC(C)[C@H]1C=C(C[C@H](O)C#CC(C)(C)O)[C@H](C)CC1 |
| InChI | InChI=1S/C17H28O2/c1-12(2)14-7-6-13(3)15(10-14)11-16(18)8-9-17(4,5)19/h10,12-14,16,18-19H,6-7,11H2,1-5H3/t13-,14-,16-/m1/s1 |
| InChIKey | QECQHWZBMPJKJJ-IIAWOOMASA-N |
| XLogP | 3.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|