C17H18N4O3S — CID 117087436
6-thiophen-2-yl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 117087436) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 6-thiophen-2-yl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-thiophen-2-yl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 117087436 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 6-thiophen-2-yl-4-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2cc(-c3cccs3)nc(N)n2)cc(OC)c1OC |
| InChI | InChI=1S/C17H18N4O3S/c1-22-12-7-10(8-13(23-2)16(12)24-3)19-15-9-11(20-17(18)21-15)14-5-4-6-25-14/h4-9H,1-3H3,(H3,18,19,20,21) |
| InChIKey | OVYWBVIROZZJOD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |