C17H17N7O — CID 117087947
N-[4-[[6-methyl-2-(pyrimidin-4-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 117087947) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[4-[[6-methyl-2-(pyrimidin-4-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-methyl-2-(pyrimidin-4-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117087947 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[4-[[6-methyl-2-(pyrimidin-4-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cc(C)nc(Nc3ccncn3)n2)cc1 |
| InChI | InChI=1S/C17H17N7O/c1-11-9-16(22-14-5-3-13(4-6-14)21-12(2)25)24-17(20-11)23-15-7-8-18-10-19-15/h3-10H,1-2H3,(H,21,25)(H2,18,19,20,22,23,24) |
| InChIKey | MRJVSDJGGBKKLB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |