C23H32N6O3 — CID 117088087
9-cyclohexyl-6-N-propyl-2-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine (PubChem CID 117088087) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 9-cyclohexyl-6-N-propyl-2-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine.
| Compound Name | 9-cyclohexyl-6-N-propyl-2-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117088087 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 9-cyclohexyl-6-N-propyl-2-N-(3,4,5-trimethoxyphenyl)purine-2,6-diamine |
| SMILES | CCCNc1nc(Nc2cc(OC)c(OC)c(OC)c2)nc2c1ncn2C1CCCCC1 |
| InChI | InChI=1S/C23H32N6O3/c1-5-11-24-21-19-22(29(14-25-19)16-9-7-6-8-10-16)28-23(27-21)26-15-12-17(30-2)20(32-4)18(13-15)31-3/h12-14,16H,5-11H2,1-4H3,(H2,24,26,27,28) |
| InChIKey | VOXOZJCIFLEMOK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |