C26H30N6O4 — CID 117088217
9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)purin-6-amine (PubChem CID 117088217) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)purin-6-amine.
| Compound Name | 9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)purin-6-amine |
|---|---|
| PubChem CID | 117088217 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 9-cyclohexyl-2-(6-methoxy-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)purin-6-amine |
| SMILES | COc1ccc(-c2nc(Nc3cc(OC)c(OC)c(OC)c3)c3ncn(C4CCCCC4)c3n2)cn1 |
| InChI | InChI=1S/C26H30N6O4/c1-33-19-12-17(13-20(34-2)23(19)36-4)29-25-22-26(32(15-28-22)18-8-6-5-7-9-18)31-24(30-25)16-10-11-21(35-3)27-14-16/h10-15,18H,5-9H2,1-4H3,(H,29,30,31) |
| InChIKey | VURZBGBLLHJWEV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |