C17H28O3 — CID 11708941
ethyl (13Z)-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate (PubChem CID 11708941) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethyl (13Z)-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate.
| Compound Name | ethyl (13Z)-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate |
|---|---|
| PubChem CID | 11708941 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethyl (13Z)-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate |
| SMILES | CCOC(=O)/C1=C2\OCCC2CCCCCCCCC1 |
| InChI | InChI=1S/C17H28O3/c1-2-19-17(18)15-11-9-7-5-3-4-6-8-10-14-12-13-20-16(14)15/h14H,2-13H2,1H3/b16-15- |
| InChIKey | MUUNNABDDWLNEV-NXVVXOECSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |