C15H20ClNO2 — CID 11708951
(2R)-2-[[4-[(E)-but-2-enoxy]-3-chlorophenyl]methyl]morpholine (PubChem CID 11708951) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is (2R)-2-[[4-[(E)-but-2-enoxy]-3-chlorophenyl]methyl]morpholine.
| Compound Name | (2R)-2-[[4-[(E)-but-2-enoxy]-3-chlorophenyl]methyl]morpholine |
|---|---|
| PubChem CID | 11708951 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (2R)-2-[[4-[(E)-but-2-enoxy]-3-chlorophenyl]methyl]morpholine |
| SMILES | C/C=C/COc1ccc(C[C@@H]2CNCCO2)cc1Cl |
| InChI | InChI=1S/C15H20ClNO2/c1-2-3-7-19-15-5-4-12(10-14(15)16)9-13-11-17-6-8-18-13/h2-5,10,13,17H,6-9,11H2,1H3/b3-2+/t13-/m1/s1 |
| InChIKey | NSUQSBSTJFBEOF-YWVDXFKGSA-N |
| XLogP | 2.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|