About 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine
4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 117089896) has the molecular formula C23H20N4O3
and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine |
| PubChem CID | 117089896 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(-c2nc(Nc3ccc(Oc4ccccc4)cc3)nc(OC)n2)cc1 |
| InChI | InChI=1S/C23H20N4O3/c1-28-18-12-8-16(9-13-18)21-25-22(27-23(26-21)29-2)24-17-10-14-20(15-11-17)30-19-6-4-3-5-7-19/h3-15H,1-2H3,(H,24,25,26,27) |
| InChIKey | LKQRXHOJTVYDRP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine?
The IUPAC name of 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine (CID 117089896) is 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine?
The canonical SMILES for 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine is COc1ccc(-c2nc(Nc3ccc(Oc4ccccc4)cc3)nc(OC)n2)cc1.
What is the InChIKey of 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine?
The InChIKey is LKQRXHOJTVYDRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3/c1-28-18-12-8-16(9-13-18)21-25-22(27-23(26-21)29-2)24-17-10-14-20(15-11-17)30-19-6-4-3-5-7-19/h3-15H,1-2H3,(H,24,25,26,27).
What are the key properties of 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine?
4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine has a molecular weight of 400.44 g/mol, XLogP of 5.09, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-(4-methoxyphenyl)-N-(4-phenoxyphenyl)-1,3,5-triazin-2-amine is sourced from PubChem (CID 117089896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).