C27H31N5O3 — CID 117089914
2-(4-morpholin-4-ylanilino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]quinoline-4-carboxamide (PubChem CID 117089914) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylanilino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-morpholin-4-ylanilino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 117089914 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 2-(4-morpholin-4-ylanilino)-N-[3-(2-oxopyrrolidin-1-yl)propyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cc(Nc2ccc(N3CCOCC3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C27H31N5O3/c33-26-7-3-13-32(26)14-4-12-28-27(34)23-19-25(30-24-6-2-1-5-22(23)24)29-20-8-10-21(11-9-20)31-15-17-35-18-16-31/h1-2,5-6,8-11,19H,3-4,7,12-18H2,(H,28,34)(H,29,30) |
| InChIKey | MULYILLBEJLNDP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|