About 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol
4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol (PubChem CID 117090164) has the molecular formula C23H28N4O3
and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol |
| PubChem CID | 117090164 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol |
| SMILES | COc1cc2nc(NC3CCC(O)CC3)nc(NCc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C23H28N4O3/c1-29-20-12-18-19(13-21(20)30-2)26-23(25-16-8-10-17(28)11-9-16)27-22(18)24-14-15-6-4-3-5-7-15/h3-7,12-13,16-17,28H,8-11,14H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | NWCKRQWQJVZQFY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol?
The IUPAC name of 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol (CID 117090164) is 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol?
The canonical SMILES for 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol is COc1cc2nc(NC3CCC(O)CC3)nc(NCc3ccccc3)c2cc1OC.
What is the InChIKey of 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol?
The InChIKey is NWCKRQWQJVZQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O3/c1-29-20-12-18-19(13-21(20)30-2)26-23(25-16-8-10-17(28)11-9-16)27-22(18)24-14-15-6-4-3-5-7-15/h3-7,12-13,16-17,28H,8-11,14H2,1-2H3,(H2,24,25,26,27).
What are the key properties of 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol?
4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol has a molecular weight of 408.50 g/mol, XLogP of 3.97, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(benzylamino)-6,7-dimethoxyquinazolin-2-yl]amino]cyclohexan-1-ol is sourced from PubChem (CID 117090164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).