C17H23F3N6 — CID 117090343
2-N,2-N,6-N-triethyl-4-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 117090343) has the molecular formula C17H23F3N6 and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-N,2-N,6-N-triethyl-4-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-triethyl-4-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117090343 |
| Molecular Formula | C17H23F3N6 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-N,2-N,6-N-triethyl-4-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(NCc2cccc(C(F)(F)F)c2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C17H23F3N6/c1-4-21-14-23-15(25-16(24-14)26(5-2)6-3)22-11-12-8-7-9-13(10-12)17(18,19)20/h7-10H,4-6,11H2,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | MUNHOXLLSFYBGY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |