C18H19N3OS — CID 117090815
N-[2-(4-methoxyphenyl)ethyl]-5-methyl-2-thiophen-2-ylpyrimidin-4-amine (PubChem CID 117090815) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-5-methyl-2-thiophen-2-ylpyrimidin-4-amine.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-5-methyl-2-thiophen-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 117090815 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-5-methyl-2-thiophen-2-ylpyrimidin-4-amine |
| SMILES | COc1ccc(CCNc2nc(-c3cccs3)ncc2C)cc1 |
| InChI | InChI=1S/C18H19N3OS/c1-13-12-20-18(16-4-3-11-23-16)21-17(13)19-10-9-14-5-7-15(22-2)8-6-14/h3-8,11-12H,9-10H2,1-2H3,(H,19,20,21) |
| InChIKey | VHMWROWFZGILPB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |