C18H27N5 — CID 117091031
N-[6-(3-aminophenyl)pyrimidin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 117091031) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is N-[6-(3-aminophenyl)pyrimidin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[6-(3-aminophenyl)pyrimidin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 117091031 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-[6-(3-aminophenyl)pyrimidin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNc1cc(-c2cccc(N)c2)ncn1)C(C)C |
| InChI | InChI=1S/C18H27N5/c1-13(2)23(14(3)4)9-8-20-18-11-17(21-12-22-18)15-6-5-7-16(19)10-15/h5-7,10-14H,8-9,19H2,1-4H3,(H,20,21,22) |
| InChIKey | PSBWMSNLTDOQFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|